ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
| نام محصول |
2-Chloro-6-iodotoluene |
| نام انگلیسی |
2-Chloro-6-iodotoluene; 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| میدان مغناطیسی |
C7H6ClI |
| وزن مولکولی |
252.48 |
| InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| شماره سیایاس |
42048-11-3 |
| ساختار مولکولی |
|
| تراکم |
1.806g/cm3 |
| نقطه غلیان |
243°C at 760 mmHg |
| ضریب شکست |
1.616 |
| نقطه اشتعال |
100.8°C |
| فشار بخار |
0.0513mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
