ChemNet > CAS > 42521-08-4 2,6-Dichloropyridine-4-carbonyl chloride
42521-08-4 2,6-Dichloropyridine-4-carbonyl chloride
نام محصول |
2,6-Dichloropyridine-4-carbonyl chloride |
نام انگلیسی |
2,6-Dichloropyridine-4-carbonyl chloride; 2,6-Dichloropyridine-4-carboxylic chloride |
میدان مغناطیسی |
C6H2Cl3NO |
وزن مولکولی |
210.4452 |
InChI |
InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
شماره سیایاس |
42521-08-4 |
ساختار مولکولی |
|
تراکم |
1.582g/cm3 |
نقطه غلیان |
280.4°C at 760 mmHg |
ضریب شکست |
1.582 |
نقطه اشتعال |
123.4°C |
فشار بخار |
0.0038mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|