ChemNet > CAS > 43020-38-8 2,3,4-Trimethoxybenzonitrile
43020-38-8 2,3,4-Trimethoxybenzonitrile
نام محصول |
2,3,4-Trimethoxybenzonitrile |
نام انگلیسی |
2,3,4-Trimethoxybenzonitrile; |
میدان مغناطیسی |
C10H11NO3 |
وزن مولکولی |
193.1992 |
InChI |
InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
شماره سیایاس |
43020-38-8 |
تعداد کمیسیون اروپایی |
256-049-5 |
ساختار مولکولی |
|
تراکم |
1.15g/cm3 |
نقطه ذوب |
55-57℃ |
نقطه غلیان |
311.1°C at 760 mmHg |
ضریب شکست |
1.514 |
نقطه اشتعال |
127.8°C |
فشار بخار |
0.000576mmHg at 25°C |
خطر نمادها |
T:Toxic;
|
کدهای خطر |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|