447-31-4 Desyl chloride
نام محصول |
Desyl chloride |
نام انگلیسی |
Desyl chloride; alpha-Chloro-alpha-phenylacetophenone; alpha-chlorodeoxybenzoin; 2-chloro-1,2-diphenylethanone; (2R)-2-chloro-1,2-diphenylethanone; (2S)-2-chloro-1,2-diphenylethanone |
میدان مغناطیسی |
C14H11ClO |
وزن مولکولی |
230.6895 |
InChI |
InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
شماره سیایاس |
447-31-4 |
تعداد کمیسیون اروپایی |
207-181-7 |
ساختار مولکولی |
|
تراکم |
1.19g/cm3 |
نقطه ذوب |
65-69℃ |
نقطه غلیان |
345.5°C at 760 mmHg |
ضریب شکست |
1.592 |
نقطه اشتعال |
190.4°C |
فشار بخار |
6.14E-05mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21:Harmful by inhalation and in contact with skin.;
R37:Irritating to respiratory system.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
|
|