ChemNet > CAS > 4472-92-8 Cinnamylidenemalonic acid
4472-92-8 Cinnamylidenemalonic acid
نام محصول |
Cinnamylidenemalonic acid |
نام انگلیسی |
Cinnamylidenemalonic acid; 2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
میدان مغناطیسی |
C12H8O4 |
وزن مولکولی |
216.1906 |
InChI |
InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
شماره سیایاس |
4472-92-8 |
تعداد کمیسیون اروپایی |
224-746-3 |
ساختار مولکولی |
|
نقطه غلیان |
484.6°C at 760 mmHg |
نقطه اشتعال |
261°C |
فشار بخار |
3.34E-10mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|