ChemNet > CAS > 4511-42-6 L-Lactide S
4511-42-6 L-Lactide S
| نام محصول |
L-Lactide S |
| نام انگلیسی |
L-Lactide S; (3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
| میدان مغناطیسی |
C6H8O4 |
| وزن مولکولی |
144.1253 |
| InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
| شماره سیایاس |
4511-42-6 |
| تعداد کمیسیون اروپایی |
224-832-0 |
| ساختار مولکولی |
|
| تراکم |
1.186g/cm3 |
| نقطه ذوب |
92-98℃ |
| نقطه غلیان |
285.5°C at 760 mmHg |
| ضریب شکست |
1.429 |
| نقطه اشتعال |
150.6°C |
| فشار بخار |
0.0028mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37:Irritating to eyes and respiratory system.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
