455-67-4 3-fluoropropiophenone
نام محصول |
3-fluoropropiophenone |
نام انگلیسی |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
میدان مغناطیسی |
C9H9FO |
وزن مولکولی |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
شماره سیایاس |
455-67-4 |
ساختار مولکولی |
|
تراکم |
1.074g/cm3 |
نقطه غلیان |
209.8°C at 760 mmHg |
ضریب شکست |
1.489 |
نقطه اشتعال |
79.8°C |
فشار بخار |
0.199mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|