ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
نام محصول |
1-(4-fluorophenyl)-2-thiourea |
نام انگلیسی |
1-(4-fluorophenyl)-2-thiourea; 4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
میدان مغناطیسی |
C7H7FN2S |
وزن مولکولی |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
شماره سیایاس |
459-05-2 |
ساختار مولکولی |
|
تراکم |
1.397g/cm3 |
نقطه ذوب |
164℃ |
نقطه غلیان |
264.2°C at 760 mmHg |
ضریب شکست |
1.692 |
نقطه اشتعال |
113.6°C |
فشار بخار |
0.00987mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R25:Toxic if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|