ChemNet > CAS > 4653-08-1 3-(2-thenoyl)propionic acid
4653-08-1 3-(2-thenoyl)propionic acid
| نام محصول |
3-(2-thenoyl)propionic acid |
| نام انگلیسی |
3-(2-thenoyl)propionic acid; 4-Oxo-4-(2-thienyl)butyric acid; 4-oxo-4-(thiophen-2-yl)butanoic acid; 4-oxo-4-thiophen-2-ylbutanoate |
| میدان مغناطیسی |
C8H7O3S |
| وزن مولکولی |
183.2049 |
| InChI |
InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
| شماره سیایاس |
4653-08-1 |
| تعداد کمیسیون اروپایی |
225-089-5 |
| ساختار مولکولی |
|
| نقطه غلیان |
400.5°C at 760 mmHg |
| نقطه اشتعال |
196°C |
| فشار بخار |
3.93E-07mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
