4731-53-7 Tri-n-octylphosphine
نام محصول |
Tri-n-octylphosphine |
نام انگلیسی |
Tri-n-octylphosphine;Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
میدان مغناطیسی |
C24H51P |
وزن مولکولی |
370.6355 |
InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
شماره سیایاس |
4731-53-7 |
تعداد کمیسیون اروپایی |
225-234-2 |
ساختار مولکولی |
|
نقطه غلیان |
445°C at 760 mmHg |
نقطه اشتعال |
236°C |
فشار بخار |
1.07E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|