ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
نام محصول |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
نام انگلیسی |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate; 5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
میدان مغناطیسی |
C11H15NO4S |
وزن مولکولی |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
شماره سیایاس |
4815-30-9 |
تعداد کمیسیون اروپایی |
225-388-0 |
ساختار مولکولی |
|
تراکم |
1.247g/cm3 |
نقطه ذوب |
103-108℃ |
نقطه غلیان |
372.6°C at 760 mmHg |
ضریب شکست |
1.558 |
نقطه اشتعال |
179.1°C |
فشار بخار |
9.51E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|