ChemNet > CAS > 4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
نام محصول |
trans-2,3-dihydroxy-1,4-dioxane |
نام انگلیسی |
trans-2,3-dihydroxy-1,4-dioxane; 2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
میدان مغناطیسی |
C4H8O4 |
وزن مولکولی |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
شماره سیایاس |
4845-50-5 |
تعداد کمیسیون اروپایی |
225-431-3 |
ساختار مولکولی |
|
تراکم |
1.455g/cm3 |
نقطه ذوب |
91-95℃ |
نقطه غلیان |
259.4°C at 760 mmHg |
ضریب شکست |
1.513 |
نقطه اشتعال |
110.7°C |
فشار بخار |
0.00189mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|