4906-24-5 3-Acetoxy-2-butanone
نام محصول |
3-Acetoxy-2-butanone |
نام انگلیسی |
3-Acetoxy-2-butanone; Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
میدان مغناطیسی |
C6H10O3 |
وزن مولکولی |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
شماره سیایاس |
4906-24-5 |
ساختار مولکولی |
|
تراکم |
1.012g/cm3 |
نقطه غلیان |
163.4°C at 760 mmHg |
ضریب شکست |
1.406 |
نقطه اشتعال |
56.6°C |
فشار بخار |
2.07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|