4917-76-4 thiodi(succinic acid)
نام محصول |
thiodi(succinic acid) |
نام انگلیسی |
thiodi(succinic acid); Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
میدان مغناطیسی |
C7H5FN2 |
وزن مولکولی |
136.1264 |
InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
شماره سیایاس |
4917-76-4 |
تعداد کمیسیون اروپایی |
225-544-8 |
ساختار مولکولی |
|
تراکم |
1.371g/cm3 |
ضریب شکست |
1.659 |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|