ChemNet > CAS > 495-71-6 1,2-Dibenzoylethane
495-71-6 1,2-Dibenzoylethane
| نام محصول |
1,2-Dibenzoylethane |
| نام انگلیسی |
1,2-Dibenzoylethane; 1,2-Dibenzoylethane,(1,4-Diphenyl-1,4-butanedione); 1,4-Diphenyl-1,4-butanedione; 1,4-diphenylbutane-1,4-dione; 1,4-diphenyl-1,4-butadione |
| میدان مغناطیسی |
C16H14O2 |
| وزن مولکولی |
238.2812 |
| InChI |
InChI=1/C16H14O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| شماره سیایاس |
495-71-6 |
| ساختار مولکولی |
|
| تراکم |
1.116g/cm3 |
| نقطه غلیان |
407.2°C at 760 mmHg |
| ضریب شکست |
1.574 |
| نقطه اشتعال |
152.5°C |
| فشار بخار |
7.67E-07mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
