501-24-6 3-n-Pentadecylphenol
نام محصول |
3-n-Pentadecylphenol |
نام انگلیسی |
3-n-Pentadecylphenol; Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
میدان مغناطیسی |
C21H36O |
وزن مولکولی |
304.5099 |
InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
شماره سیایاس |
501-24-6 |
تعداد کمیسیون اروپایی |
207-921-9 |
ساختار مولکولی |
|
تراکم |
0.908g/cm3 |
نقطه ذوب |
47-53℃ |
نقطه غلیان |
402°C at 760 mmHg |
ضریب شکست |
1.495 |
نقطه اشتعال |
246.3°C |
فشار بخار |
4.88E-07mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|