ChemNet > CAS > 50528-80-8 2,4,6-Trifluorophenyl isocyanate
50528-80-8 2,4,6-Trifluorophenyl isocyanate
| نام محصول |
2,4,6-Trifluorophenyl isocyanate |
| نام انگلیسی |
2,4,6-Trifluorophenyl isocyanate; 1,3,5-trifluoro-2-isocyanatobenzene |
| میدان مغناطیسی |
C7H2F3NO |
| وزن مولکولی |
173.0921 |
| InChI |
InChI=1/C7H2F3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| شماره سیایاس |
50528-80-8 |
| ساختار مولکولی |
|
| تراکم |
1.35g/cm3 |
| نقطه غلیان |
166.4°C at 760 mmHg |
| ضریب شکست |
1.473 |
| نقطه اشتعال |
52.2°C |
| فشار بخار |
1.79mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
