ChemNet > CAS > 50533-97-6 4-dimethylaminopiperidine
50533-97-6 4-dimethylaminopiperidine
نام محصول |
4-dimethylaminopiperidine |
نام انگلیسی |
4-dimethylaminopiperidine; 4-(Dimethylamino)piperidine; N,N-dimethylpiperidin-4-amine |
میدان مغناطیسی |
C7H16N2 |
وزن مولکولی |
128.2153 |
InChI |
InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
شماره سیایاس |
50533-97-6 |
تعداد کمیسیون اروپایی |
256-617-2 |
ساختار مولکولی |
|
تراکم |
0.91g/cm3 |
نقطه غلیان |
179.7°C at 760 mmHg |
ضریب شکست |
1.479 |
نقطه اشتعال |
63.3°C |
فشار بخار |
0.929mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|