ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
نام محصول |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
نام انگلیسی |
Methyl 2-nitro-3,4,5-trimethoxybenzoate; 2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
میدان مغناطیسی |
C11H13NO7 |
وزن مولکولی |
271.2234 |
InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
شماره سیایاس |
5081-42-5 |
تعداد کمیسیون اروپایی |
225-794-8 |
ساختار مولکولی |
|
تراکم |
1.284g/cm3 |
نقطه غلیان |
420°C at 760 mmHg |
ضریب شکست |
1.523 |
نقطه اشتعال |
188.9°C |
فشار بخار |
2.9E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|