ChemNet > CAS > 51446-31-2 4-Fluoro-3-hydroxybenzoic acid
51446-31-2 4-Fluoro-3-hydroxybenzoic acid
نام محصول |
4-Fluoro-3-hydroxybenzoic acid |
نام انگلیسی |
4-Fluoro-3-hydroxybenzoic acid; (4-fluorophenyl)(3-phenyloxiran-2-yl)methanone; 4-fluoro-3-hydroxybenzoate; 3-Hydroxy-4-fluorobenzoic acid |
میدان مغناطیسی |
C7H4FO3 |
وزن مولکولی |
155.1038 |
InChI |
InChI=1/C7H5FO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)/p-1 |
شماره سیایاس |
51446-31-2 |
ساختار مولکولی |
|
نقطه غلیان |
324°C at 760 mmHg |
نقطه اشتعال |
149.7°C |
فشار بخار |
0.000104mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|