ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
| نام محصول |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| نام انگلیسی |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; |
| میدان مغناطیسی |
C10H7ClN4 |
| وزن مولکولی |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
| شماره سیایاس |
51516-67-7 |
| ساختار مولکولی |
|
| تراکم |
1.41g/cm3 |
| نقطه ذوب |
170℃ |
| نقطه غلیان |
424.2°C at 760 mmHg |
| ضریب شکست |
1.686 |
| نقطه اشتعال |
210.4°C |
| فشار بخار |
2.1E-07mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
