ChemNet > CAS > 51627-47-5 2-مورفولینو-3-پیریدینامین؛ 2-مورفولین-4-ایلپیریدین-3-امین؛ 3-امینو-2-مورفولین-4-ایلپیریدینیوم؛
51627-47-5 2-مورفولینو-3-پیریدینامین؛ 2-مورفولین-4-ایلپیریدین-3-امین؛ 3-امینو-2-مورفولین-4-ایلپیریدینیوم؛
| نام محصول |
2-مورفولینو-3-پیریدینامین؛ 2-مورفولین-4-ایلپیریدین-3-امین؛ 3-امینو-2-مورفولین-4-ایلپیریدینیوم؛ |
| نام انگلیسی |
2-morpholino-3-pyridinamine;2-morpholin-4-ylpyridin-3-amine; 3-amino-2-morpholin-4-ylpyridinium |
| میدان مغناطیسی |
C9H14N3O |
| وزن مولکولی |
180.2264 |
| InChI |
InChI=1/C9H13N3O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7,10H2/p+1 |
| شماره سیایاس |
51627-47-5 |
| ساختار مولکولی |
|
| نقطه غلیان |
381.9°C at 760 mmHg |
| نقطه اشتعال |
184.8°C |
| فشار بخار |
4.91E-06mmHg at 25°C |
| خطر نمادها |
Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|