526-73-8 1,2,3-Trimethylbenzene
نام محصول |
1,2,3-Trimethylbenzene |
نام انگلیسی |
1,2,3-Trimethylbenzene; hemimellitene |
میدان مغناطیسی |
C9H12 |
وزن مولکولی |
120.19 |
InChI |
InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
شماره سیایاس |
526-73-8 |
تعداد کمیسیون اروپایی |
208-394-8 |
ساختار مولکولی |
|
تراکم |
0.894 |
نقطه ذوب |
-25℃ |
نقطه غلیان |
175-176℃ |
ضریب شکست |
1.513 |
نقطه اشتعال |
53℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R10:;
R37:;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|