527-61-7 2,6-Dimethylbenzoquinone
نام محصول |
2,6-Dimethylbenzoquinone |
نام انگلیسی |
2,6-Dimethylbenzoquinone; |
میدان مغناطیسی |
C8H8O2 |
وزن مولکولی |
136.15 |
InChI |
InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
شماره سیایاس |
527-61-7 |
تعداد کمیسیون اروپایی |
208-420-8 |
ساختار مولکولی |
|
نقطه ذوب |
69-74℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|