ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
نام محصول |
Methyl 2-amino-5-bromobenzoate |
نام انگلیسی |
Methyl 2-amino-5-bromobenzoate; 2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
میدان مغناطیسی |
C8H8BrNO2 |
وزن مولکولی |
230.0586 |
InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
شماره سیایاس |
52727-57-8 |
ساختار مولکولی |
|
تراکم |
1.578g/cm3 |
نقطه ذوب |
72-74℃ |
نقطه غلیان |
286.3°C at 760 mmHg |
ضریب شکست |
1.601 |
نقطه اشتعال |
126.9°C |
فشار بخار |
0.00266mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|