ChemNet > CAS > 5279-32-3 1,2-Dibromo-4,5-(methylenedioxy)benzene
5279-32-3 1,2-Dibromo-4,5-(methylenedioxy)benzene
| نام محصول |
1,2-Dibromo-4,5-(methylenedioxy)benzene |
| نام انگلیسی |
1,2-Dibromo-4,5-(methylenedioxy)benzene; 5,6-Dibromo-1,3-benzodioxole; 4,5-Methylenedioxy-1,2-dibromobenzene; 5,6-dibromo-1,3-benzodioxole; 1,2-Dibromo-4,5-(methylenedioxy) benzene; 3-(trifluoromethyl)sulphanylaniline |
| میدان مغناطیسی |
C7H4Br2O2 |
| وزن مولکولی |
279.9135 |
| InChI |
InChI=1/C7H4Br2O2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,3H2 |
| شماره سیایاس |
5279-32-3 |
| ساختار مولکولی |
|
| تراکم |
2.104g/cm3 |
| نقطه غلیان |
294.7°C at 760 mmHg |
| ضریب شکست |
1.638 |
| نقطه اشتعال |
118.1°C |
| فشار بخار |
0.00281mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
