5326-38-5 2-Iodo-5-nitrotoluene
نام محصول |
2-Iodo-5-nitrotoluene |
نام انگلیسی |
2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
میدان مغناطیسی |
C16H15N3O |
وزن مولکولی |
265.3098 |
InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
شماره سیایاس |
5326-38-5 |
تعداد کمیسیون اروپایی |
226-204-1 |
ساختار مولکولی |
|
تراکم |
1.217g/cm3 |
نقطه غلیان |
531.5°C at 760 mmHg |
ضریب شکست |
1.665 |
نقطه اشتعال |
275.2°C |
فشار بخار |
2.23E-11mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|