53293-00-8 5-Hexynoic acid
نام محصول |
5-Hexynoic acid |
نام انگلیسی |
5-Hexynoic acid; Hex-5-ynoic acid; hex-5-ynoate |
میدان مغناطیسی |
C6H7O2 |
وزن مولکولی |
111.1191 |
InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
شماره سیایاس |
53293-00-8 |
ساختار مولکولی |
|
نقطه غلیان |
220.6°C at 760 mmHg |
نقطه اشتعال |
99.6°C |
فشار بخار |
0.042mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|