ChemNet > CAS > 5345-89-1 2,6-Dichlorocinnamic acid
5345-89-1 2,6-Dichlorocinnamic acid
| نام محصول |
2,6-Dichlorocinnamic acid |
| نام انگلیسی |
2,6-Dichlorocinnamic acid;Cinnamic acid, 2,6-dichloro- (6CI,7CI); 3-(2,6-Dichlorophenyl)-2-propenoic acid; NSC 1762; 2-Propenoic acid, 3-(2,6-dichlorophenyl)-; 3,4-dihydroisoquinolin-2(1H)-yl(thiophen-2-yl)methanone; (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid; (2E)-3-(2,6-dichlorophenyl)prop-2-enoate |
| میدان مغناطیسی |
C9H5Cl2O2 |
| وزن مولکولی |
216.0413 |
| InChI |
InChI=1/C9H6Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
| شماره سیایاس |
5345-89-1 |
| تعداد کمیسیون اروپایی |
226-301-9 |
| ساختار مولکولی |
|
| نقطه ذوب |
192-196℃ |
| نقطه غلیان |
355.8°C at 760 mmHg |
| نقطه اشتعال |
169°C |
| فشار بخار |
1.12E-05mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R37/38:Irritating to respiratory system and skin.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
|
|
