538-65-8 butyl cinnamate
نام محصول |
butyl cinnamate |
نام انگلیسی |
butyl cinnamate; n-Butyl cinnamate, (Cinnamic acid n-butyl ester); Cinnamic acid n-butyl ester; n-Butyl cinnamate; butyl 3-phenylprop-2-enoate; butyl (2E)-3-phenylprop-2-enoate |
میدان مغناطیسی |
C13H16O2 |
وزن مولکولی |
204.2649 |
InChI |
InChI=1/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3/b10-9+ |
شماره سیایاس |
538-65-8 |
تعداد کمیسیون اروپایی |
208-699-6 |
ساختار مولکولی |
|
تراکم |
1.021g/cm3 |
نقطه غلیان |
302.7°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
163.8°C |
فشار بخار |
0.000974mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|