ChemNet > CAS > 5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
| نام محصول |
ethyl 4-amino-3,5-diiodobenzoate |
| نام انگلیسی |
ethyl 4-amino-3,5-diiodobenzoate; |
| میدان مغناطیسی |
C9H9I2NO2 |
| وزن مولکولی |
416.9822 |
| InChI |
InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
| شماره سیایاس |
5400-81-7 |
| ساختار مولکولی |
|
| تراکم |
2.191g/cm3 |
| نقطه ذوب |
148℃ |
| نقطه غلیان |
449.1°C at 760 mmHg |
| ضریب شکست |
1.689 |
| نقطه اشتعال |
225.4°C |
| فشار بخار |
2.93E-08mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
