ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| نام محصول |
p-Diethylaminoacetophenone |
| نام انگلیسی |
p-Diethylaminoacetophenone; 4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| میدان مغناطیسی |
C12H17NO |
| وزن مولکولی |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| شماره سیایاس |
5520-66-1 |
| ساختار مولکولی |
|
| تراکم |
0.996g/cm3 |
| نقطه غلیان |
313.9°C at 760 mmHg |
| ضریب شکست |
1.536 |
| نقطه اشتعال |
114.4°C |
| فشار بخار |
0.000482mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
