ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| نام محصول |
3-Methylthiophene-2-carbonitrile |
| نام انگلیسی |
3-Methylthiophene-2-carbonitrile; 2-Cyano-3-methylthiophene |
| میدان مغناطیسی |
C6H5NS |
| وزن مولکولی |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| شماره سیایاس |
55406-13-8 |
| ساختار مولکولی |
|
| تراکم |
1.16g/cm3 |
| نقطه غلیان |
212.7°C at 760 mmHg |
| ضریب شکست |
1.556 |
| نقطه اشتعال |
82.4°C |
| فشار بخار |
0.171mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
