ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
نام محصول |
2,3-Dichloroacetophenone |
نام انگلیسی |
2,3-Dichloroacetophenone; 1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
میدان مغناطیسی |
C8H6Cl2O |
وزن مولکولی |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
شماره سیایاس |
56041-57-7 |
تعداد کمیسیون اروپایی |
259-954-3 |
ساختار مولکولی |
|
تراکم |
1.304g/cm3 |
نقطه ذوب |
106℃ |
نقطه غلیان |
247.3°C at 760 mmHg |
ضریب شکست |
1.548 |
نقطه اشتعال |
101.3°C |
فشار بخار |
0.0258mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|