ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
نام محصول |
1,5-Dimethyl-2-pyrrolecarbonitrile |
نام انگلیسی |
1,5-Dimethyl-2-pyrrolecarbonitrile; 1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
میدان مغناطیسی |
C7H8N2 |
وزن مولکولی |
120.1518 |
InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
شماره سیایاس |
56341-36-7 |
تعداد کمیسیون اروپایی |
260-120-6 |
ساختار مولکولی |
|
تراکم |
0.98g/cm3 |
نقطه ذوب |
53-56℃ |
نقطه غلیان |
238.9°C at 760 mmHg |
ضریب شکست |
1.529 |
نقطه اشتعال |
104.4°C |
فشار بخار |
0.0414mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21:Harmful by inhalation and in contact with skin.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|