ChemNet > CAS > 56961-25-2 4-Amino-3,5-dichlorobenzoic acid
56961-25-2 4-Amino-3,5-dichlorobenzoic acid
نام محصول |
4-Amino-3,5-dichlorobenzoic acid |
نام انگلیسی |
4-Amino-3,5-dichlorobenzoic acid;Benzoic acid, 4-amino-3,5-dichloro-; 4-14-00-01279 (Beilstein Handbook Reference); AI3-33338; BRN 2805751; NAB-930; 4-amino-3,5-dichlorobenzoate |
میدان مغناطیسی |
C7H4Cl2NO2 |
وزن مولکولی |
205.0187 |
InChI |
InChI=1/C7H5Cl2NO2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,10H2,(H,11,12)/p-1 |
شماره سیایاس |
56961-25-2 |
تعداد کمیسیون اروپایی |
260-468-9 |
ساختار مولکولی |
|
نقطه غلیان |
344.2°C at 760 mmHg |
نقطه اشتعال |
162°C |
فشار بخار |
2.56E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|