ChemNet > CAS > 57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
نام محصول |
6-amino-1,3-dihydroisobenzofuran-1-one |
نام انگلیسی |
6-amino-1,3-dihydroisobenzofuran-1-one; 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
میدان مغناطیسی |
C8H7NO2 |
وزن مولکولی |
149.1467 |
InChI |
InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
شماره سیایاس |
57319-65-0 |
تعداد کمیسیون اروپایی |
260-675-4 |
ساختار مولکولی |
|
تراکم |
1.376g/cm3 |
نقطه ذوب |
182℃ |
نقطه غلیان |
420.2°C at 760 mmHg |
ضریب شکست |
1.655 |
نقطه اشتعال |
248.3°C |
فشار بخار |
2.87E-07mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|