ChemNet > CAS > 576-82-9 5-فلورو-1،2،3-tribromobenzene؛ ؛ 1،2،3-Tribromo-5-fluorobenzene؛
576-82-9 5-فلورو-1،2،3-tribromobenzene؛ ؛ 1،2،3-Tribromo-5-fluorobenzene؛
| نام محصول |
5-فلورو-1،2،3-tribromobenzene؛ ؛ 1،2،3-Tribromo-5-fluorobenzene؛ |
| نام انگلیسی |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
| میدان مغناطیسی |
C6H2Br3F |
| وزن مولکولی |
332.7905 |
| InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
| شماره سیایاس |
576-82-9 |
| ساختار مولکولی |
|
| تراکم |
2.34g/cm3 |
| نقطه غلیان |
274.2°C at 760 mmHg |
| ضریب شکست |
1.61 |
| نقطه اشتعال |
119.6°C |
| فشار بخار |
0.0092mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
