5785-06-8 3-Methoxybenzhydrazide
نام محصول |
3-Methoxybenzhydrazide |
نام انگلیسی |
3-Methoxybenzhydrazide; m-Anisic hydrazide; 3-Methoxybenzoic hydrazide; 3-methoxybenzohydrazide |
میدان مغناطیسی |
C8H10N2O2 |
وزن مولکولی |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-12-7-4-2-3-6(5-7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
شماره سیایاس |
5785-06-8 |
تعداد کمیسیون اروپایی |
227-310-0 |
ساختار مولکولی |
|
تراکم |
1.178g/cm3 |
نقطه ذوب |
91℃ |
ضریب شکست |
1.558 |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|