ChemNet > CAS > 5785-66-0 Cyclopropyl diphenyl carbinol
5785-66-0 Cyclopropyl diphenyl carbinol
نام محصول |
Cyclopropyl diphenyl carbinol |
نام انگلیسی |
Cyclopropyl diphenyl carbinol; alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
میدان مغناطیسی |
C12H14N4O |
وزن مولکولی |
230.2658 |
InChI |
InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
شماره سیایاس |
5785-66-0 |
تعداد کمیسیون اروپایی |
227-312-1 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه ذوب |
82-85℃ |
نقطه غلیان |
419°C at 760 mmHg |
ضریب شکست |
1.59 |
نقطه اشتعال |
207.2°C |
فشار بخار |
3.13E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|