ChemNet > CAS > 5820-22-4 Methallyl phenyl ether
5820-22-4 Methallyl phenyl ether
| نام محصول |
Methallyl phenyl ether |
| نام انگلیسی |
Methallyl phenyl ether; 2-Methyl-2-propenyl phenyl ether; p-Methallyl chlorobenzene; [(2-methylprop-2-en-1-yl)oxy]benzene |
| میدان مغناطیسی |
C10H12O |
| وزن مولکولی |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-9(2)8-11-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
| شماره سیایاس |
5820-22-4 |
| تعداد کمیسیون اروپایی |
227-393-3 |
| ساختار مولکولی |
|
| تراکم |
0.938g/cm3 |
| نقطه غلیان |
175.5°C at 760 mmHg |
| ضریب شکست |
1.499 |
| نقطه اشتعال |
77°C |
| فشار بخار |
1.54mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
