ChemNet > CAS > 589-17-3 4-Bromobenzyl chloride
589-17-3 4-Bromobenzyl chloride
| نام محصول |
4-Bromobenzyl chloride |
| نام انگلیسی |
4-Bromobenzyl chloride; 4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
| میدان مغناطیسی |
C7H6BrCl |
| وزن مولکولی |
205.4795 |
| InChI |
InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| شماره سیایاس |
589-17-3 |
| تعداد کمیسیون اروپایی |
209-638-6 |
| ساختار مولکولی |
|
| تراکم |
1.541g/cm3 |
| نقطه ذوب |
36-40℃ |
| نقطه غلیان |
236°C at 760 mmHg |
| ضریب شکست |
1.569 |
| نقطه اشتعال |
111.7°C |
| فشار بخار |
0.0744mmHg at 25°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| توضیحات ایمنی |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
