589-55-9 4-Heptanol
نام محصول |
4-Heptanol |
نام انگلیسی |
4-Heptanol; Dipropylcarbinol; heptan-4-ol |
میدان مغناطیسی |
C7H16O |
وزن مولکولی |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
شماره سیایاس |
589-55-9 |
تعداد کمیسیون اروپایی |
209-651-7 |
ساختار مولکولی |
|
تراکم |
0.818g/cm3 |
نقطه غلیان |
161.3°C at 760 mmHg |
ضریب شکست |
1.42 |
نقطه اشتعال |
61.8°C |
فشار بخار |
0.792mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R10:Flammable.;
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|