589-62-8 4-octanol
نام محصول |
4-octanol |
نام انگلیسی |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
میدان مغناطیسی |
C8H18O |
وزن مولکولی |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
شماره سیایاس |
589-62-8 |
تعداد کمیسیون اروپایی |
209-654-3 |
ساختار مولکولی |
|
تراکم |
0.821g/cm3 |
نقطه غلیان |
179.2°C at 760 mmHg |
ضریب شکست |
1.426 |
نقطه اشتعال |
71.1°C |
فشار بخار |
0.284mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|