589-82-2 3-Heptanol
نام محصول |
3-Heptanol |
نام انگلیسی |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
میدان مغناطیسی |
C7H16O |
وزن مولکولی |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
شماره سیایاس |
589-82-2 |
تعداد کمیسیون اروپایی |
209-661-1 |
ساختار مولکولی |
|
تراکم |
0.818g/cm3 |
نقطه ذوب |
-70℃ |
نقطه غلیان |
156.7°C at 760 mmHg |
ضریب شکست |
1.42 |
نقطه اشتعال |
54.4°C |
فشار بخار |
1.03mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|