58971-11-2 3-Bromophenethylamine
نام محصول |
3-Bromophenethylamine |
نام انگلیسی |
3-Bromophenethylamine;2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
میدان مغناطیسی |
C8H10BrN |
وزن مولکولی |
200.0757 |
InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
شماره سیایاس |
58971-11-2 |
ساختار مولکولی |
|
تراکم |
1.407g/cm3 |
نقطه غلیان |
263.4°C at 760 mmHg |
ضریب شکست |
1.575 |
نقطه اشتعال |
113.1°C |
فشار بخار |
0.0103mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|