ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| نام محصول |
4-(difluoromethoxy)bromobenzene |
| نام انگلیسی |
4-(difluoromethoxy)bromobenzene; 1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| میدان مغناطیسی |
C7H5BrF2O |
| وزن مولکولی |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| شماره سیایاس |
5905-69-1 |
| ساختار مولکولی |
|
| تراکم |
1.583g/cm3 |
| نقطه غلیان |
205.406°C at 760 mmHg |
| ضریب شکست |
1.492 |
| نقطه اشتعال |
92.591°C |
| فشار بخار |
0.359mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
