598-25-4 3-Methyl-1,2-butadiene
نام محصول |
3-Methyl-1,2-butadiene |
نام انگلیسی |
3-Methyl-1,2-butadiene; 3,3-Dimethylallene; 3-methylbuta-1,2-diene |
میدان مغناطیسی |
C5H8 |
وزن مولکولی |
68.117 |
InChI |
InChI=1/C5H8/c1-4-5(2)3/h1H2,2-3H3 |
شماره سیایاس |
598-25-4 |
تعداد کمیسیون اروپایی |
209-926-1 |
ساختار مولکولی |
|
تراکم |
0.651g/cm3 |
نقطه غلیان |
43.3°C at 760 mmHg |
ضریب شکست |
1.389 |
فشار بخار |
391mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S33:Take precautionary measures against static discharges.;
|
|