ChemNet > CAS > 603-80-5 3-Hydroxy-2-Methyl Benzoic Acid
603-80-5 3-Hydroxy-2-Methyl Benzoic Acid
| نام محصول |
3-Hydroxy-2-Methyl Benzoic Acid |
| نام انگلیسی |
3-Hydroxy-2-Methyl Benzoic Acid; 3-Hydroxy-2-methylbenzoic acid; Hydroxytoluicacid; 3-Hydroxy-o-toluic acid; 2-methyl-3-hydroxybenzoic acid; 3-hydroxy-2-methylbenzoate; 2-Methyl-3-hydroxy benzoic acid |
| میدان مغناطیسی |
C8H7O3 |
| وزن مولکولی |
151.1399 |
| InChI |
InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
| شماره سیایاس |
603-80-5 |
| ساختار مولکولی |
|
| نقطه ذوب |
143-148℃ |
| نقطه غلیان |
336.6°C at 760 mmHg |
| نقطه اشتعال |
171.6°C |
| فشار بخار |
4.36E-05mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
