606-26-8 2-Nitrobenzhydrazide
نام محصول |
2-Nitrobenzhydrazide |
نام انگلیسی |
2-Nitrobenzhydrazide; 2-Nitrobenzoic hydrazide; 2-Nitrobenzoyl hydrazide; 2-nitrobenzohydrazide |
میدان مغناطیسی |
C7H7N3O3 |
وزن مولکولی |
181.1488 |
InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
شماره سیایاس |
606-26-8 |
تعداد کمیسیون اروپایی |
210-110-2 |
ساختار مولکولی |
|
تراکم |
1.406g/cm3 |
نقطه ذوب |
123℃ |
ضریب شکست |
1.621 |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|